C14H14N2O4 — CID 69014425
1-(2,4-dihydroxyphenyl)-3-(3-methoxyphenyl)urea (PubChem CID 69014425) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-3-(3-methoxyphenyl)urea.
| Compound Name | 1-(2,4-dihydroxyphenyl)-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 69014425 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C14H14N2O4/c1-20-11-4-2-3-9(7-11)15-14(19)16-12-6-5-10(17)8-13(12)18/h2-8,17-18H,1H3,(H2,15,16,19) |
| InChIKey | YAQCFSVUTTUBCA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|