C28H40N2O5Si — CID 69014460
[(1R,2S)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamic acid (PubChem CID 69014460) has the molecular formula C28H40N2O5Si and a molecular weight of 512.72 g/mol. Its IUPAC name is [(1R,2S)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamic acid.
| Compound Name | [(1R,2S)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 69014460 |
| Molecular Formula | C28H40N2O5Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | [(1R,2S)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H]1NC(=O)O |
| InChI | InChI=1S/C28H40N2O5Si/c1-27(2,3)34-26(33)30-23-18-17-20(19-24(23)29-25(31)32)35-36(28(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24,29H,17-19H2,1-6H3,(H,30,33)(H,31,32)/t20?,23-,24+/m0/s1 |
| InChIKey | WDNGJBDTKCJWQM-VXSFFCHMSA-N |
| XLogP | 4.64 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|