C20H27Cl2FN4O3S — CID 69014570
[2-[(E)-[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] (2S)-2-amino-4-methylpentanoate;dihydrochloride (PubChem CID 69014570) has the molecular formula C20H27Cl2FN4O3S and a molecular weight of 493.43 g/mol. Its IUPAC name is [2-[(E)-[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] (2S)-2-amino-4-methylpentanoate;dihydrochloride.
| Compound Name | [2-[(E)-[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] (2S)-2-amino-4-methylpentanoate;dihydrochloride |
|---|---|
| PubChem CID | 69014570 |
| Molecular Formula | C20H27Cl2FN4O3S |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | [2-[(E)-[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] (2S)-2-amino-4-methylpentanoate;dihydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)Oc1cc(F)ccc1/C=C1/SC(N2CCCCN2)=NC1=O.Cl.Cl |
| InChI | InChI=1S/C20H25FN4O3S.2ClH/c1-12(2)9-15(22)19(27)28-16-11-14(21)6-5-13(16)10-17-18(26)24-20(29-17)25-8-4-3-7-23-25;;/h5-6,10-12,15,23H,3-4,7-9,22H2,1-2H3;2*1H/b17-10+;;/t15-;;/m0../s1 |
| InChIKey | YWJIESLAZPMYGT-NOZBPHARSA-N |
| XLogP | 3.52 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|