C23H26N6O5S — CID 69014852
[4-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]-1-bicyclo[2.2.2]octanyl]carbamic acid (PubChem CID 69014852) has the molecular formula C23H26N6O5S and a molecular weight of 498.57 g/mol. Its IUPAC name is [4-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]-1-bicyclo[2.2.2]octanyl]carbamic acid.
| Compound Name | [4-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]-1-bicyclo[2.2.2]octanyl]carbamic acid |
|---|---|
| PubChem CID | 69014852 |
| Molecular Formula | C23H26N6O5S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [4-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]-1-bicyclo[2.2.2]octanyl]carbamic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(NNC(=O)C45CCC(NC(=O)O)(CC4)CC5)cnc32)cc1 |
| InChI | InChI=1S/C23H26N6O5S/c1-15-2-4-16(5-3-15)35(33,34)29-13-6-17-19(29)24-14-18(25-17)27-28-20(30)22-7-10-23(11-8-22,12-9-22)26-21(31)32/h2-6,13-14,26H,7-12H2,1H3,(H,25,27)(H,28,30)(H,31,32) |
| InChIKey | WMOUNZYWFMGYRV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 155.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|