C23H12Cl4N2O — CID 69014975
bis(2,5-dichloro-3-pyridin-4-ylphenyl)methanone (PubChem CID 69014975) has the molecular formula C23H12Cl4N2O and a molecular weight of 474.17 g/mol. Its IUPAC name is bis(2,5-dichloro-3-pyridin-4-ylphenyl)methanone.
| Compound Name | bis(2,5-dichloro-3-pyridin-4-ylphenyl)methanone |
|---|---|
| PubChem CID | 69014975 |
| Molecular Formula | C23H12Cl4N2O |
| Molecular Weight | 474.17 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | bis(2,5-dichloro-3-pyridin-4-ylphenyl)methanone |
| SMILES | O=C(c1cc(Cl)cc(-c2ccncc2)c1Cl)c1cc(Cl)cc(-c2ccncc2)c1Cl |
| InChI | InChI=1S/C23H12Cl4N2O/c24-15-9-17(13-1-5-28-6-2-13)21(26)19(11-15)23(30)20-12-16(25)10-18(22(20)27)14-3-7-29-8-4-14/h1-12H |
| InChIKey | APOIMSDULHLNSQ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.17 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |