About azane;5-methoxy-6-methyl-1,2,4-triazine
azane;5-methoxy-6-methyl-1,2,4-triazine (PubChem CID 69015199) has the molecular formula C5H10N4O
and a molecular weight of 142.16 g/mol. Its IUPAC name is azane;5-methoxy-6-methyl-1,2,4-triazine.
Molecular Properties
| Compound Name | azane;5-methoxy-6-methyl-1,2,4-triazine |
| PubChem CID | 69015199 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | azane;5-methoxy-6-methyl-1,2,4-triazine |
| SMILES | COc1ncnnc1C.N |
| InChI | InChI=1S/C5H7N3O.H3N/c1-4-5(9-2)6-3-7-8-4;/h3H,1-2H3;1H3 |
| InChIKey | YMHLGEXAJBUORB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 82.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;5-methoxy-6-methyl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-methoxy-6-methyl-1,2,4-triazine?
The IUPAC name of azane;5-methoxy-6-methyl-1,2,4-triazine (CID 69015199) is azane;5-methoxy-6-methyl-1,2,4-triazine.
What is the SMILES notation for azane;5-methoxy-6-methyl-1,2,4-triazine?
The canonical SMILES for azane;5-methoxy-6-methyl-1,2,4-triazine is COc1ncnnc1C.N.
What is the InChIKey of azane;5-methoxy-6-methyl-1,2,4-triazine?
The InChIKey is YMHLGEXAJBUORB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O.H3N/c1-4-5(9-2)6-3-7-8-4;/h3H,1-2H3;1H3.
What are the key properties of azane;5-methoxy-6-methyl-1,2,4-triazine?
azane;5-methoxy-6-methyl-1,2,4-triazine has a molecular weight of 142.16 g/mol, XLogP of 0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-methoxy-6-methyl-1,2,4-triazine is sourced from PubChem (CID 69015199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).