About [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate
[1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate (PubChem CID 69015260) has the molecular formula C20H23F2N3O2
and a molecular weight of 375.42 g/mol. Its IUPAC name is [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate.
Molecular Properties
| Compound Name | [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate |
| PubChem CID | 69015260 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate |
| SMILES | CC(C)(Cc1cccc(-c2ccc(F)cc2F)n1)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-20(2,27-19(26)25-10-8-23-9-11-25)13-15-4-3-5-18(24-15)16-7-6-14(21)12-17(16)22/h3-7,12,23H,8-11,13H2,1-2H3 |
| InChIKey | KWYVYZLOBFKKCR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate?
The IUPAC name of [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate (CID 69015260) is [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate.
What is the SMILES notation for [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate?
The canonical SMILES for [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate is CC(C)(Cc1cccc(-c2ccc(F)cc2F)n1)OC(=O)N1CCNCC1.
What is the InChIKey of [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate?
The InChIKey is KWYVYZLOBFKKCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2N3O2/c1-20(2,27-19(26)25-10-8-23-9-11-25)13-15-4-3-5-18(24-15)16-7-6-14(21)12-17(16)22/h3-7,12,23H,8-11,13H2,1-2H3.
What are the key properties of [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate?
[1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate has a molecular weight of 375.42 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[6-(2,4-difluorophenyl)-2-pyridinyl]-2-methylpropan-2-yl] piperazine-1-carboxylate is sourced from PubChem (CID 69015260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).