C29H32N4O2 — CID 69015363
4-N-cyclohexyl-6-(4-ethoxy-3-phenylmethoxyphenyl)quinazoline-2,4-diamine (PubChem CID 69015363) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-(4-ethoxy-3-phenylmethoxyphenyl)quinazoline-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-6-(4-ethoxy-3-phenylmethoxyphenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 69015363 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 4-N-cyclohexyl-6-(4-ethoxy-3-phenylmethoxyphenyl)quinazoline-2,4-diamine |
| SMILES | CCOc1ccc(-c2ccc3nc(N)nc(NC4CCCCC4)c3c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H32N4O2/c1-2-34-26-16-14-22(18-27(26)35-19-20-9-5-3-6-10-20)21-13-15-25-24(17-21)28(33-29(30)32-25)31-23-11-7-4-8-12-23/h3,5-6,9-10,13-18,23H,2,4,7-8,11-12,19H2,1H3,(H3,30,31,32,33) |
| InChIKey | IVLHSYABKBORRV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |