C31H24N4O9S2 — CID 69015870
4-[1-hydroxy-1-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]ethyl]benzoic acid;2-oxo-1H-benzo[cd]indole-5-sulfonamide (PubChem CID 69015870) has the molecular formula C31H24N4O9S2 and a molecular weight of 660.69 g/mol. Its IUPAC name is 4-[1-hydroxy-1-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]ethyl]benzoic acid;2-oxo-1H-benzo[cd]indole-5-sulfonamide.
| Compound Name | 4-[1-hydroxy-1-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]ethyl]benzoic acid;2-oxo-1H-benzo[cd]indole-5-sulfonamide |
|---|---|
| PubChem CID | 69015870 |
| Molecular Formula | C31H24N4O9S2 |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.10 |
| IUPAC Name | 4-[1-hydroxy-1-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]ethyl]benzoic acid;2-oxo-1H-benzo[cd]indole-5-sulfonamide |
| SMILES | CC(O)(NS(=O)(=O)c1ccc2c3c(cccc13)C(=O)N2)c1ccc(C(=O)O)cc1.NS(=O)(=O)c1ccc2c3c(cccc13)NC2=O |
| InChI | InChI=1S/C20H16N2O6S.C11H8N2O3S/c1-20(26,12-7-5-11(6-8-12)19(24)25)22-29(27,28)16-10-9-15-17-13(16)3-2-4-14(17)18(23)21-15;12-17(15,16)9-5-4-7-10-6(9)2-1-3-8(10)13-11(7)14/h2-10,22,26H,1H3,(H,21,23)(H,24,25);1-5H,(H,13,14)(H2,12,15,16) |
| InChIKey | CNLQZHWKZBCSHR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 222.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|