About 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine
6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine (PubChem CID 69016508) has the molecular formula C24H29N3O3
and a molecular weight of 407.51 g/mol. Its IUPAC name is 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine |
| PubChem CID | 69016508 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine |
| SMILES | CC(C)CCNc1ncnc2ccc(-c3cccc(OCCC4OCCO4)c3)cc12 |
| InChI | InChI=1S/C24H29N3O3/c1-17(2)8-10-25-24-21-15-19(6-7-22(21)26-16-27-24)18-4-3-5-20(14-18)28-11-9-23-29-12-13-30-23/h3-7,14-17,23H,8-13H2,1-2H3,(H,25,26,27) |
| InChIKey | CUORWDOJZCFFJM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine?
The IUPAC name of 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine (CID 69016508) is 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine.
What is the SMILES notation for 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine?
The canonical SMILES for 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine is CC(C)CCNc1ncnc2ccc(-c3cccc(OCCC4OCCO4)c3)cc12.
What is the InChIKey of 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine?
The InChIKey is CUORWDOJZCFFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O3/c1-17(2)8-10-25-24-21-15-19(6-7-22(21)26-16-27-24)18-4-3-5-20(14-18)28-11-9-23-29-12-13-30-23/h3-7,14-17,23H,8-13H2,1-2H3,(H,25,26,27).
What are the key properties of 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine?
6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine has a molecular weight of 407.51 g/mol, XLogP of 4.90, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]-N-(3-methylbutyl)quinazolin-4-amine is sourced from PubChem (CID 69016508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).