C23H16BrN5 — CID 69016702
4-N-(3-bromophenyl)-6-quinolin-8-ylquinazoline-2,4-diamine (PubChem CID 69016702) has the molecular formula C23H16BrN5 and a molecular weight of 442.32 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-6-quinolin-8-ylquinazoline-2,4-diamine.
| Compound Name | 4-N-(3-bromophenyl)-6-quinolin-8-ylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 69016702 |
| Molecular Formula | C23H16BrN5 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 4-N-(3-bromophenyl)-6-quinolin-8-ylquinazoline-2,4-diamine |
| SMILES | Nc1nc(Nc2cccc(Br)c2)c2cc(-c3cccc4cccnc34)ccc2n1 |
| InChI | InChI=1S/C23H16BrN5/c24-16-6-2-7-17(13-16)27-22-19-12-15(9-10-20(19)28-23(25)29-22)18-8-1-4-14-5-3-11-26-21(14)18/h1-13H,(H3,25,27,28,29) |
| InChIKey | IOLCVEGJFYCMAA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |