5-cyclopentylhexanoic acid

C11H20O2 — CID 69016722

IUPAC5-cyclopentylhexanoic acid
SMILESCC(CCCC(=O)O)C1CCCC1
InChIInChI=1S/C11H20O2/c1-9(5-4-8-11(12)13)10-6-2-3-7-10/h9-10H,2-8H2,1H3,(H,12,13)
InChIKeyPNIAUKQMAMOQID-UHFFFAOYSA-N
MW184.28 g/mol
LogP3.07
Rot. Bonds5

About 5-cyclopentylhexanoic acid

5-cyclopentylhexanoic acid (PubChem CID 69016722) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-cyclopentylhexanoic acid.

Molecular Properties

Compound Name5-cyclopentylhexanoic acid
PubChem CID69016722
Molecular FormulaC11H20O2
Molecular Weight184.28 g/mol
Exact Mass184.15
IUPAC Name5-cyclopentylhexanoic acid
SMILESCC(CCCC(=O)O)C1CCCC1
InChIInChI=1S/C11H20O2/c1-9(5-4-8-11(12)13)10-6-2-3-7-10/h9-10H,2-8H2,1H3,(H,12,13)
InChIKeyPNIAUKQMAMOQID-UHFFFAOYSA-N
XLogP3.07
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.28
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 5-cyclopentylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

6-cyclopentyl-5-methylhexanoic acid
CID 70074229
6-cyclohexyl-5-methylhexanoic acid
CID 70072548
5-cyclohexyl-4-methylhexanoic acid
CID 174468115
4-[3-cyclohexylbutanoyl(methyl)amino]butanoic acid
CID 119172655
5-cyclobutyl-5-(dimethylamino)pentanoic acid
CID 116907953
6-[[(1R)-1-cyclopentylethyl]amino]-6-oxohexanoic acid
CID 81385721
5-[[(1S)-1-cycloheptylethyl]amino]-5-oxopentanoic acid
CID 81391268
4-[1-cyclopentylethyl(methyl)amino]butanoic acid
CID 65068332
(3S,6S)-3-amino-6-cyclohexylheptanoic acid
CID 68869022
5-(cyclopentanecarbonylamino)hexanoic acid
CID 82854691
6-(1-cyclohexylethylamino)-6-oxohexanoic acid
CID 62405389
(3S)-3-cyclobutylbutanoic acid
CID 96733267

Frequently Asked Questions

What is the IUPAC name of 5-cyclopentylhexanoic acid?
The IUPAC name of 5-cyclopentylhexanoic acid (CID 69016722) is 5-cyclopentylhexanoic acid.
What is the SMILES notation for 5-cyclopentylhexanoic acid?
The canonical SMILES for 5-cyclopentylhexanoic acid is CC(CCCC(=O)O)C1CCCC1.
What is the InChIKey of 5-cyclopentylhexanoic acid?
The InChIKey is PNIAUKQMAMOQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-9(5-4-8-11(12)13)10-6-2-3-7-10/h9-10H,2-8H2,1H3,(H,12,13).
What are the key properties of 5-cyclopentylhexanoic acid?
5-cyclopentylhexanoic acid has a molecular weight of 184.28 g/mol, XLogP of 3.07, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentylhexanoic acid is sourced from PubChem (CID 69016722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).