C29H44N2O — CID 69017041
[(10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]urea (PubChem CID 69017041) has the molecular formula C29H44N2O and a molecular weight of 436.68 g/mol. Its IUPAC name is [(10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]urea.
| Compound Name | [(10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]urea |
|---|---|
| PubChem CID | 69017041 |
| Molecular Formula | C29H44N2O |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.35 |
| IUPAC Name | [(10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]urea |
| SMILES | CC(C)[C@@H](C)C=C[C@@H](C)[C@H]1CCC2=C3C=CC4=CC(NC(N)=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H44N2O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(31-27(30)32)13-15-28(21,5)26(23)14-16-29(24,25)6/h7-10,17-20,22,24,26H,11-16H2,1-6H3,(H3,30,31,32)/t19-,20+,22?,24+,26?,28-,29+/m0/s1 |
| InChIKey | QMRIXJXCSWHXLU-FORSVAEGSA-N |
| XLogP | 6.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|