C22H19F3N5O3S+ — CID 69017704
[6-[[benzyl(ethyl)carbamoyl]amino]-2-(1,3-thiazol-4-yl)-3H-benzimidazol-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 69017704) has the molecular formula C22H19F3N5O3S+ and a molecular weight of 490.49 g/mol. Its IUPAC name is [6-[[benzyl(ethyl)carbamoyl]amino]-2-(1,3-thiazol-4-yl)-3H-benzimidazol-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [6-[[benzyl(ethyl)carbamoyl]amino]-2-(1,3-thiazol-4-yl)-3H-benzimidazol-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69017704 |
| Molecular Formula | C22H19F3N5O3S+ |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [6-[[benzyl(ethyl)carbamoyl]amino]-2-(1,3-thiazol-4-yl)-3H-benzimidazol-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CCN(Cc1ccccc1)C(=O)Nc1ccc2[nH]c(-c3cscn3)[n+](OC(=O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C22H18F3N5O3S/c1-2-29(11-14-6-4-3-5-7-14)21(32)27-15-8-9-16-18(10-15)30(33-20(31)22(23,24)25)19(28-16)17-12-34-13-26-17/h3-10,12-13H,2,11H2,1H3,(H,27,32)/p+1 |
| InChIKey | RWQJEJFRGLJZFD-UHFFFAOYSA-O |
| XLogP | 4.15 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|