About 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine
5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine (PubChem CID 69017775) has the molecular formula C20H14ClF2NO2
and a molecular weight of 373.79 g/mol. Its IUPAC name is 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine.
Molecular Properties
| Compound Name | 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine |
| PubChem CID | 69017775 |
| Molecular Formula | C20H14ClF2NO2 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine |
| SMILES | Fc1cccc(F)c1C1CCc2cc(Oc3ccc(Cl)cn3)ccc2O1 |
| InChI | InChI=1S/C20H14ClF2NO2/c21-13-5-9-19(24-11-13)25-14-6-8-17-12(10-14)4-7-18(26-17)20-15(22)2-1-3-16(20)23/h1-3,5-6,8-11,18H,4,7H2 |
| InChIKey | HRLONPYZSAKBDH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine?
The IUPAC name of 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine (CID 69017775) is 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine.
What is the SMILES notation for 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine?
The canonical SMILES for 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine is Fc1cccc(F)c1C1CCc2cc(Oc3ccc(Cl)cn3)ccc2O1.
What is the InChIKey of 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine?
The InChIKey is HRLONPYZSAKBDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14ClF2NO2/c21-13-5-9-19(24-11-13)25-14-6-8-17-12(10-14)4-7-18(26-17)20-15(22)2-1-3-16(20)23/h1-3,5-6,8-11,18H,4,7H2.
What are the key properties of 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine?
5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine has a molecular weight of 373.79 g/mol, XLogP of 5.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[[2-(2,6-difluorophenyl)-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine is sourced from PubChem (CID 69017775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).