C29H28N4O — CID 69017939
2-[6-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]propanenitrile (PubChem CID 69017939) has the molecular formula C29H28N4O and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-[6-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]propanenitrile.
| Compound Name | 2-[6-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]propanenitrile |
|---|---|
| PubChem CID | 69017939 |
| Molecular Formula | C29H28N4O |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2-[6-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]propanenitrile |
| SMILES | CCOc1nc2c(C)cc(C)nc2n1Cc1ccc2c(c1)CCc1ccccc1C2=C(C)C#N |
| InChI | InChI=1S/C29H28N4O/c1-5-34-29-32-27-18(2)14-20(4)31-28(27)33(29)17-21-10-13-25-23(15-21)12-11-22-8-6-7-9-24(22)26(25)19(3)16-30/h6-10,13-15H,5,11-12,17H2,1-4H3 |
| InChIKey | DMQNSCVAZAIXGA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|