C15H21N5 — CID 6901821
N,N-dipropyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline (PubChem CID 6901821) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is N,N-dipropyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline.
| Compound Name | N,N-dipropyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline |
|---|---|
| PubChem CID | 6901821 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N,N-dipropyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline |
| SMILES | CCCN(CCC)c1ccc(/C=N/n2cnnc2)cc1 |
| InChI | InChI=1S/C15H21N5/c1-3-9-19(10-4-2)15-7-5-14(6-8-15)11-18-20-12-16-17-13-20/h5-8,11-13H,3-4,9-10H2,1-2H3/b18-11+ |
| InChIKey | UXDXUEIKQPRJBJ-WOJGMQOQSA-N |
| XLogP | 2.79 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|