C21H30O15 — CID 69018697
ethyl 4-hydroxy-3,5-bis[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]benzoate (PubChem CID 69018697) has the molecular formula C21H30O15 and a molecular weight of 522.46 g/mol. Its IUPAC name is ethyl 4-hydroxy-3,5-bis[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]benzoate.
| Compound Name | ethyl 4-hydroxy-3,5-bis[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]benzoate |
|---|---|
| PubChem CID | 69018697 |
| Molecular Formula | C21H30O15 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | ethyl 4-hydroxy-3,5-bis[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]benzoate |
| SMILES | CCOC(=O)c1cc(OC2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c(O)c(OC2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H30O15/c1-2-32-19(31)7-3-8(33-20-17(29)15(27)13(25)10(5-22)35-20)12(24)9(4-7)34-21-18(30)16(28)14(26)11(6-23)36-21/h3-4,10-11,13-18,20-30H,2,5-6H2,1H3/t10-,11-,13+,14+,15+,16+,17-,18-,20?,21?/m1/s1 |
| InChIKey | CSBDLSSARXGFOQ-YFDOCHQXSA-N |
| XLogP | -4.07 |
| TPSA | 245.29 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |