C19H21NO — CID 69019014
(7aR)-1-methyl-3,3-diphenyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 69019014) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (7aR)-1-methyl-3,3-diphenyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (7aR)-1-methyl-3,3-diphenyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 69019014 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (7aR)-1-methyl-3,3-diphenyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | CC1OC(c2ccccc2)(c2ccccc2)N2CCC[C@H]12 |
| InChI | InChI=1S/C19H21NO/c1-15-18-13-8-14-20(18)19(21-15,16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,15,18H,8,13-14H2,1H3/t15?,18-/m1/s1 |
| InChIKey | CQSVYLNIAMLLJE-KPMSDPLLSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |