C27H38O3 — CID 69019422
8-tricyclo[5.2.1.02,6]dec-7-enyl 2,4-dimethyl-5-oxo-3-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-3-enoate (PubChem CID 69019422) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 8-tricyclo[5.2.1.02,6]dec-7-enyl 2,4-dimethyl-5-oxo-3-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-3-enoate.
| Compound Name | 8-tricyclo[5.2.1.02,6]dec-7-enyl 2,4-dimethyl-5-oxo-3-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-3-enoate |
|---|---|
| PubChem CID | 69019422 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 8-tricyclo[5.2.1.02,6]dec-7-enyl 2,4-dimethyl-5-oxo-3-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-3-enoate |
| SMILES | CC(=O)C(C)=C(C(C)C(=O)OC1=C2CC(C1)C1CCCC21)C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C27H38O3/c1-15-9-8-12-27(5,6)25(15)24(16(2)18(4)28)17(3)26(29)30-23-14-19-13-22(23)21-11-7-10-20(19)21/h9,17,19-21,25H,7-8,10-14H2,1-6H3 |
| InChIKey | SLUOHNNPUBPGHC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|