About [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid
[5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid (PubChem CID 69019650) has the molecular formula C9H9F3N2O2
and a molecular weight of 234.18 g/mol. Its IUPAC name is [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid.
Molecular Properties
| Compound Name | [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid |
| PubChem CID | 69019650 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1ccc(CC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H9F3N2O2/c10-9(11,12)3-6-1-2-7(13-4-6)5-14-8(15)16/h1-2,4,14H,3,5H2,(H,15,16) |
| InChIKey | HYOOJTHKMSIZLM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid?
The IUPAC name of [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid (CID 69019650) is [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid.
What is the SMILES notation for [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid?
The canonical SMILES for [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid is O=C(O)NCc1ccc(CC(F)(F)F)cn1.
What is the InChIKey of [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid?
The InChIKey is HYOOJTHKMSIZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2O2/c10-9(11,12)3-6-1-2-7(13-4-6)5-14-8(15)16/h1-2,4,14H,3,5H2,(H,15,16).
What are the key properties of [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid?
[5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid has a molecular weight of 234.18 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,2,2-trifluoroethyl)-2-pyridinyl]methylcarbamic acid is sourced from PubChem (CID 69019650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).