C16H14BrNOS — CID 690197
(2S)-2-(4-bromophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 690197) has the molecular formula C16H14BrNOS and a molecular weight of 348.27 g/mol. Its IUPAC name is (2S)-2-(4-bromophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2S)-2-(4-bromophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 690197 |
| Molecular Formula | C16H14BrNOS |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | (2S)-2-(4-bromophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)CS[C@H]2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H14BrNOS/c1-11-2-8-14(9-3-11)18-15(19)10-20-16(18)12-4-6-13(17)7-5-12/h2-9,16H,10H2,1H3/t16-/m0/s1 |
| InChIKey | IFZZINHKFFAFDG-INIZCTEOSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |