About N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine
N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine (PubChem CID 69020192) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine |
| PubChem CID | 69020192 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine |
| SMILES | CN(C)CC1([N+](=O)[O-])C=CCC=C1 |
| InChI | InChI=1S/C9H14N2O2/c1-10(2)8-9(11(12)13)6-4-3-5-7-9/h4-7H,3,8H2,1-2H3 |
| InChIKey | TXOXBYQMISLPTL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine?
The IUPAC name of N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine (CID 69020192) is N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine.
What is the SMILES notation for N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine?
The canonical SMILES for N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine is CN(C)CC1([N+](=O)[O-])C=CCC=C1.
What is the InChIKey of N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine?
The InChIKey is TXOXBYQMISLPTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-10(2)8-9(11(12)13)6-4-3-5-7-9/h4-7H,3,8H2,1-2H3.
What are the key properties of N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine?
N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine has a molecular weight of 182.22 g/mol, XLogP of 1.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(1-nitrocyclohexa-2,5-dien-1-yl)methanamine is sourced from PubChem (CID 69020192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).