C18H14N2O4S — CID 69020503
9-anilino-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8-carboxylic acid (PubChem CID 69020503) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is 9-anilino-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8-carboxylic acid.
| Compound Name | 9-anilino-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 69020503 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 9-anilino-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8-carboxylic acid |
| SMILES | O=C(O)c1cnc2ccc3c(c2c1Nc1ccccc1)CCS3(=O)=O |
| InChI | InChI=1S/C18H14N2O4S/c21-18(22)13-10-19-14-6-7-15-12(8-9-25(15,23)24)16(14)17(13)20-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,19,20)(H,21,22) |
| InChIKey | PSLUETYZDMMYPR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |