About 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid
5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid (PubChem CID 69020568) has the molecular formula C8H8FNO4
and a molecular weight of 201.15 g/mol. Its IUPAC name is 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid |
| PubChem CID | 69020568 |
| Molecular Formula | C8H8FNO4 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid |
| SMILES | COc1c(F)cnc(C(=O)O)c1OC |
| InChI | InChI=1S/C8H8FNO4/c1-13-6-4(9)3-10-5(8(11)12)7(6)14-2/h3H,1-2H3,(H,11,12) |
| InChIKey | OFNSODRWYFRKRN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid?
The IUPAC name of 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid (CID 69020568) is 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid.
What is the SMILES notation for 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid?
The canonical SMILES for 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid is COc1c(F)cnc(C(=O)O)c1OC.
What is the InChIKey of 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid?
The InChIKey is OFNSODRWYFRKRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNO4/c1-13-6-4(9)3-10-5(8(11)12)7(6)14-2/h3H,1-2H3,(H,11,12).
What are the key properties of 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid?
5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid has a molecular weight of 201.15 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,4-dimethoxypyridine-2-carboxylic acid is sourced from PubChem (CID 69020568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).