C19H34F3NOSSi — CID 69020859
(2S)-4-methyl-1-triethylsilyloxy-N-[(1S)-2,2,2-trifluoro-1-(4-methylthiophen-2-yl)ethyl]pentan-2-amine (PubChem CID 69020859) has the molecular formula C19H34F3NOSSi and a molecular weight of 409.63 g/mol. Its IUPAC name is (2S)-4-methyl-1-triethylsilyloxy-N-[(1S)-2,2,2-trifluoro-1-(4-methylthiophen-2-yl)ethyl]pentan-2-amine.
| Compound Name | (2S)-4-methyl-1-triethylsilyloxy-N-[(1S)-2,2,2-trifluoro-1-(4-methylthiophen-2-yl)ethyl]pentan-2-amine |
|---|---|
| PubChem CID | 69020859 |
| Molecular Formula | C19H34F3NOSSi |
| Molecular Weight | 409.63 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (2S)-4-methyl-1-triethylsilyloxy-N-[(1S)-2,2,2-trifluoro-1-(4-methylthiophen-2-yl)ethyl]pentan-2-amine |
| SMILES | CC[Si](CC)(CC)OC[C@H](CC(C)C)N[C@H](c1cc(C)cs1)C(F)(F)F |
| InChI | InChI=1S/C19H34F3NOSSi/c1-7-26(8-2,9-3)24-12-16(10-14(4)5)23-18(19(20,21)22)17-11-15(6)13-25-17/h11,13-14,16,18,23H,7-10,12H2,1-6H3/t16-,18+/m0/s1 |
| InChIKey | DPGRMJQGKIGYME-FUHWJXTLSA-N |
| XLogP | 6.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|