About 2-fluoro-3,4-dimethoxypyridine
2-fluoro-3,4-dimethoxypyridine (PubChem CID 69021121) has the molecular formula C7H8FNO2
and a molecular weight of 157.14 g/mol. Its IUPAC name is 2-fluoro-3,4-dimethoxypyridine.
Molecular Properties
| Compound Name | 2-fluoro-3,4-dimethoxypyridine |
| PubChem CID | 69021121 |
| Molecular Formula | C7H8FNO2 |
| Molecular Weight | 157.14 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 2-fluoro-3,4-dimethoxypyridine |
| SMILES | COc1ccnc(F)c1OC |
| InChI | InChI=1S/C7H8FNO2/c1-10-5-3-4-9-7(8)6(5)11-2/h3-4H,1-2H3 |
| InChIKey | FZEATTGQUHEFPC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.14 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3,4-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,4-dimethoxypyridine?
The IUPAC name of 2-fluoro-3,4-dimethoxypyridine (CID 69021121) is 2-fluoro-3,4-dimethoxypyridine.
What is the SMILES notation for 2-fluoro-3,4-dimethoxypyridine?
The canonical SMILES for 2-fluoro-3,4-dimethoxypyridine is COc1ccnc(F)c1OC.
What is the InChIKey of 2-fluoro-3,4-dimethoxypyridine?
The InChIKey is FZEATTGQUHEFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO2/c1-10-5-3-4-9-7(8)6(5)11-2/h3-4H,1-2H3.
What are the key properties of 2-fluoro-3,4-dimethoxypyridine?
2-fluoro-3,4-dimethoxypyridine has a molecular weight of 157.14 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,4-dimethoxypyridine is sourced from PubChem (CID 69021121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).