About 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine
4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine (PubChem CID 69022167) has the molecular formula C10H14FNO2
and a molecular weight of 199.22 g/mol. Its IUPAC name is 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine.
Molecular Properties
| Compound Name | 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine |
| PubChem CID | 69022167 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine |
| SMILES | CCOc1c(C)c(C)nc(F)c1OC |
| InChI | InChI=1S/C10H14FNO2/c1-5-14-8-6(2)7(3)12-10(11)9(8)13-4/h5H2,1-4H3 |
| InChIKey | HEVACLGFFAPEPE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine?
The IUPAC name of 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine (CID 69022167) is 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine.
What is the SMILES notation for 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine?
The canonical SMILES for 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine is CCOc1c(C)c(C)nc(F)c1OC.
What is the InChIKey of 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine?
The InChIKey is HEVACLGFFAPEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNO2/c1-5-14-8-6(2)7(3)12-10(11)9(8)13-4/h5H2,1-4H3.
What are the key properties of 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine?
4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine has a molecular weight of 199.22 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2-fluoro-3-methoxy-5,6-dimethylpyridine is sourced from PubChem (CID 69022167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).