C16H14N2O2S — CID 690223
ethyl 3-amino-6-phenylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 690223) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is ethyl 3-amino-6-phenylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 3-amino-6-phenylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 690223 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl 3-amino-6-phenylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(-c3ccccc3)ccc2c1N |
| InChI | InChI=1S/C16H14N2O2S/c1-2-20-16(19)14-13(17)11-8-9-12(18-15(11)21-14)10-6-4-3-5-7-10/h3-9H,2,17H2,1H3 |
| InChIKey | RHLVCLJIDVQESM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |