About 5-chloro-1,3-thiazole-4-carboxylic acid
5-chloro-1,3-thiazole-4-carboxylic acid (PubChem CID 69022623) has the molecular formula C4H2ClNO2S
and a molecular weight of 163.59 g/mol. Its IUPAC name is 5-chloro-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-chloro-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 69022623 |
| Molecular Formula | C4H2ClNO2S |
| Molecular Weight | 163.59 g/mol |
| Exact Mass | 162.95 |
| IUPAC Name | 5-chloro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1Cl |
| InChI | InChI=1S/C4H2ClNO2S/c5-3-2(4(7)8)6-1-9-3/h1H,(H,7,8) |
| InChIKey | VFCFYIDCFCQUFD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.59 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-chloro-1,3-thiazole-4-carboxylic acid (CID 69022623) is 5-chloro-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-chloro-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-chloro-1,3-thiazole-4-carboxylic acid is O=C(O)c1ncsc1Cl.
What is the InChIKey of 5-chloro-1,3-thiazole-4-carboxylic acid?
The InChIKey is VFCFYIDCFCQUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClNO2S/c5-3-2(4(7)8)6-1-9-3/h1H,(H,7,8).
What are the key properties of 5-chloro-1,3-thiazole-4-carboxylic acid?
5-chloro-1,3-thiazole-4-carboxylic acid has a molecular weight of 163.59 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 69022623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).