C15H26N4O10 — CID 69022653
(E)-but-2-enedioic acid;1-methyl-1-[2-oxo-2-[(2R,3R,5R,6R)-3,4,5-trihydroxy-2,6-bis(hydroxymethyl)piperidin-1-yl]ethyl]guanidine (PubChem CID 69022653) has the molecular formula C15H26N4O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-methyl-1-[2-oxo-2-[(2R,3R,5R,6R)-3,4,5-trihydroxy-2,6-bis(hydroxymethyl)piperidin-1-yl]ethyl]guanidine.
| Compound Name | (E)-but-2-enedioic acid;1-methyl-1-[2-oxo-2-[(2R,3R,5R,6R)-3,4,5-trihydroxy-2,6-bis(hydroxymethyl)piperidin-1-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 69022653 |
| Molecular Formula | C15H26N4O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (E)-but-2-enedioic acid;1-methyl-1-[2-oxo-2-[(2R,3R,5R,6R)-3,4,5-trihydroxy-2,6-bis(hydroxymethyl)piperidin-1-yl]ethyl]guanidine |
| SMILES | O=C(O)/C=C/C(=O)O.[H]/N=C(\N)N(C)CC(=O)N1[C@H](CO)[C@@H](O)C(O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C11H22N4O6.C4H4O4/c1-14(11(12)13)2-7(18)15-5(3-16)8(19)10(21)9(20)6(15)4-17;5-3(6)1-2-4(7)8/h5-6,8-10,16-17,19-21H,2-4H2,1H3,(H3,12,13);1-2H,(H,5,6)(H,7,8)/b;2-1+/t5-,6-,8-,9-;/m1./s1 |
| InChIKey | YQLSQWSTLLSBLF-GPCULWDDSA-N |
| XLogP | -4.83 |
| TPSA | 249.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|