C24H29Cl3N6 — CID 69024255
2-[(1R,3R)-3-[[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride (PubChem CID 69024255) has the molecular formula C24H29Cl3N6 and a molecular weight of 507.90 g/mol. Its IUPAC name is 2-[(1R,3R)-3-[[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride.
| Compound Name | 2-[(1R,3R)-3-[[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 69024255 |
| Molecular Formula | C24H29Cl3N6 |
| Molecular Weight | 507.90 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 2-[(1R,3R)-3-[[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride |
| SMILES | Cc1ccc2nc(C=Cc3ccc(Cl)cc3)nc(N[C@@H]3CCC[C@@H](N=C(N)N)C3)c2c1.Cl.Cl |
| InChI | InChI=1S/C24H27ClN6.2ClH/c1-15-5-11-21-20(13-15)23(28-18-3-2-4-19(14-18)29-24(26)27)31-22(30-21)12-8-16-6-9-17(25)10-7-16;;/h5-13,18-19H,2-4,14H2,1H3,(H4,26,27,29)(H,28,30,31);2*1H/t18-,19-;;/m1../s1 |
| InChIKey | LEHMTPNAORRMGH-BAMQSBMESA-N |
| XLogP | 5.60 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|