C41H65N5O4 — CID 69024449
5-cyclohexyl-1-(4-cyclohexylpiperazin-1-yl)pentan-1-one;3-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-1,3-benzoxazol-2-one (PubChem CID 69024449) has the molecular formula C41H65N5O4 and a molecular weight of 692.00 g/mol. Its IUPAC name is 5-cyclohexyl-1-(4-cyclohexylpiperazin-1-yl)pentan-1-one;3-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-1,3-benzoxazol-2-one.
| Compound Name | 5-cyclohexyl-1-(4-cyclohexylpiperazin-1-yl)pentan-1-one;3-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 69024449 |
| Molecular Formula | C41H65N5O4 |
| Molecular Weight | 692.00 g/mol |
| Exact Mass | 691.50 |
| IUPAC Name | 5-cyclohexyl-1-(4-cyclohexylpiperazin-1-yl)pentan-1-one;3-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-1,3-benzoxazol-2-one |
| SMILES | O=C(CCCCC1CCCCC1)N1CCN(C2CCCCC2)CC1.O=C(CCn1c(=O)oc2ccccc21)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H38N2O.C20H27N3O3/c24-21(14-8-7-11-19-9-3-1-4-10-19)23-17-15-22(16-18-23)20-12-5-2-6-13-20;24-19(10-11-23-17-8-4-5-9-18(17)26-20(23)25)22-14-12-21(13-15-22)16-6-2-1-3-7-16/h19-20H,1-18H2;4-5,8-9,16H,1-3,6-7,10-15H2 |
| InChIKey | WDRTWNNWKFEADG-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 82.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.00 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|