C25H24ClN5O2 — CID 69024890
N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[(3R)-piperidin-3-yl]oxyquinazolin-4-amine (PubChem CID 69024890) has the molecular formula C25H24ClN5O2 and a molecular weight of 461.95 g/mol. Its IUPAC name is N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[(3R)-piperidin-3-yl]oxyquinazolin-4-amine.
| Compound Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[(3R)-piperidin-3-yl]oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 69024890 |
| Molecular Formula | C25H24ClN5O2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[(3R)-piperidin-3-yl]oxyquinazolin-4-amine |
| SMILES | Clc1cc(Nc2ncnc3cccc(O[C@@H]4CCCNC4)c23)ccc1OCc1ccccn1 |
| InChI | InChI=1S/C25H24ClN5O2/c26-20-13-17(9-10-22(20)32-15-18-5-1-2-12-28-18)31-25-24-21(29-16-30-25)7-3-8-23(24)33-19-6-4-11-27-14-19/h1-3,5,7-10,12-13,16,19,27H,4,6,11,14-15H2,(H,29,30,31)/t19-/m1/s1 |
| InChIKey | OSGQQHHRPNPAFV-LJQANCHMSA-N |
| XLogP | 5.13 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |