C23H27N3O4S — CID 69025262
tert-butyl N-methyl-N-[3-[2-[(7-nitro-1H-indol-3-yl)sulfanyl]phenyl]propyl]carbamate (PubChem CID 69025262) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-[2-[(7-nitro-1H-indol-3-yl)sulfanyl]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-[2-[(7-nitro-1H-indol-3-yl)sulfanyl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 69025262 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | tert-butyl N-methyl-N-[3-[2-[(7-nitro-1H-indol-3-yl)sulfanyl]phenyl]propyl]carbamate |
| SMILES | CN(CCCc1ccccc1Sc1c[nH]c2c([N+](=O)[O-])cccc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H27N3O4S/c1-23(2,3)30-22(27)25(4)14-8-10-16-9-5-6-13-19(16)31-20-15-24-21-17(20)11-7-12-18(21)26(28)29/h5-7,9,11-13,15,24H,8,10,14H2,1-4H3 |
| InChIKey | CLXGIZCVZDZGBP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|