C23H27ClN2O2S — CID 69025409
tert-butyl N-[3-[2-[(4-chloro-1H-indol-3-yl)sulfanyl]phenyl]propyl]-N-methylcarbamate (PubChem CID 69025409) has the molecular formula C23H27ClN2O2S and a molecular weight of 431.00 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[(4-chloro-1H-indol-3-yl)sulfanyl]phenyl]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[2-[(4-chloro-1H-indol-3-yl)sulfanyl]phenyl]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 69025409 |
| Molecular Formula | C23H27ClN2O2S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | tert-butyl N-[3-[2-[(4-chloro-1H-indol-3-yl)sulfanyl]phenyl]propyl]-N-methylcarbamate |
| SMILES | CN(CCCc1ccccc1Sc1c[nH]c2cccc(Cl)c12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H27ClN2O2S/c1-23(2,3)28-22(27)26(4)14-8-10-16-9-5-6-13-19(16)29-20-15-25-18-12-7-11-17(24)21(18)20/h5-7,9,11-13,15,25H,8,10,14H2,1-4H3 |
| InChIKey | RSPQPHNQIXKKLF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |