About 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol
2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol (PubChem CID 69025830) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 69025830 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol |
| SMILES | CC1(N)C=CC(O)=C(N)C1 |
| InChI | InChI=1S/C7H12N2O/c1-7(9)3-2-6(10)5(8)4-7/h2-3,10H,4,8-9H2,1H3 |
| InChIKey | LLWLQTNQRFXXPZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol?
The IUPAC name of 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol (CID 69025830) is 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol is CC1(N)C=CC(O)=C(N)C1.
What is the InChIKey of 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol?
The InChIKey is LLWLQTNQRFXXPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-7(9)3-2-6(10)5(8)4-7/h2-3,10H,4,8-9H2,1H3.
What are the key properties of 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol?
2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol has a molecular weight of 140.19 g/mol, XLogP of 0.39, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-4-methylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 69025830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).