About 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid
4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid (PubChem CID 69026152) has the molecular formula C21H17F2NO4
and a molecular weight of 385.37 g/mol. Its IUPAC name is 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid |
| PubChem CID | 69026152 |
| Molecular Formula | C21H17F2NO4 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(-n2c(C)cc(OCc3cccc(F)c3F)cc2=O)ccc1C(=O)O |
| InChI | InChI=1S/C21H17F2NO4/c1-12-8-15(6-7-17(12)21(26)27)24-13(2)9-16(10-19(24)25)28-11-14-4-3-5-18(22)20(14)23/h3-10H,11H2,1-2H3,(H,26,27) |
| InChIKey | LPFLEXRIRKHEFU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid?
The IUPAC name of 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid (CID 69026152) is 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid.
What is the SMILES notation for 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid?
The canonical SMILES for 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid is Cc1cc(-n2c(C)cc(OCc3cccc(F)c3F)cc2=O)ccc1C(=O)O.
What is the InChIKey of 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid?
The InChIKey is LPFLEXRIRKHEFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F2NO4/c1-12-8-15(6-7-17(12)21(26)27)24-13(2)9-16(10-19(24)25)28-11-14-4-3-5-18(22)20(14)23/h3-10H,11H2,1-2H3,(H,26,27).
What are the key properties of 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid?
4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid has a molecular weight of 385.37 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,3-difluorophenyl)methoxy]-2-methyl-6-oxo-1-pyridinyl]-2-methylbenzoic acid is sourced from PubChem (CID 69026152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).