About 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one
3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one (PubChem CID 69026159) has the molecular formula C32H41N3O2
and a molecular weight of 499.70 g/mol. Its IUPAC name is 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one |
| PubChem CID | 69026159 |
| Molecular Formula | C32H41N3O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one |
| SMILES | CCc1c(N)ccc(C2(c3ccc(N)c(CC)c3CC)OC(=O)c3cc(N(CC)CC)ccc32)c1CC |
| InChI | InChI=1S/C32H41N3O2/c1-7-21-23(9-3)29(33)17-15-26(21)32(27-16-18-30(34)24(10-4)22(27)8-2)28-14-13-20(35(11-5)12-6)19-25(28)31(36)37-32/h13-19H,7-12,33-34H2,1-6H3 |
| InChIKey | LQIUBNZYHRIUEB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one?
The IUPAC name of 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one (CID 69026159) is 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one.
What is the SMILES notation for 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one?
The canonical SMILES for 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one is CCc1c(N)ccc(C2(c3ccc(N)c(CC)c3CC)OC(=O)c3cc(N(CC)CC)ccc32)c1CC.
What is the InChIKey of 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one?
The InChIKey is LQIUBNZYHRIUEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H41N3O2/c1-7-21-23(9-3)29(33)17-15-26(21)32(27-16-18-30(34)24(10-4)22(27)8-2)28-14-13-20(35(11-5)12-6)19-25(28)31(36)37-32/h13-19H,7-12,33-34H2,1-6H3.
What are the key properties of 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one?
3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one has a molecular weight of 499.70 g/mol, XLogP of 6.41, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(4-amino-2,3-diethylphenyl)-6-(diethylamino)-2-benzofuran-1-one is sourced from PubChem (CID 69026159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).