C18H16F2N4O5S — CID 6902625
(E)-4-[4-(difluoromethoxy)phenyl]-N-(2-methoxyethyl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 6902625) has the molecular formula C18H16F2N4O5S and a molecular weight of 438.41 g/mol. Its IUPAC name is (E)-4-[4-(difluoromethoxy)phenyl]-N-(2-methoxyethyl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (E)-4-[4-(difluoromethoxy)phenyl]-N-(2-methoxyethyl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6902625 |
| Molecular Formula | C18H16F2N4O5S |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (E)-4-[4-(difluoromethoxy)phenyl]-N-(2-methoxyethyl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H16F2N4O5S/c1-27-9-8-21-18-23(22-10-14-6-7-16(28-14)24(25)26)15(11-30-18)12-2-4-13(5-3-12)29-17(19)20/h2-7,10-11,17H,8-9H2,1H3/b21-18-,22-10+ |
| InChIKey | DKMFHYRFBVJKKJ-HNRAKDTKSA-N |
| XLogP | 3.75 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|