About 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine
6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine (PubChem CID 69026533) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine.
Molecular Properties
| Compound Name | 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine |
| PubChem CID | 69026533 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine |
| SMILES | CNC1(N)C=CC=C(OC)N1 |
| InChI | InChI=1S/C7H13N3O/c1-9-7(8)5-3-4-6(10-7)11-2/h3-5,9-10H,8H2,1-2H3 |
| InChIKey | IMZOFYAUDSMTTP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine?
The IUPAC name of 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine (CID 69026533) is 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine.
What is the SMILES notation for 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine?
The canonical SMILES for 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine is CNC1(N)C=CC=C(OC)N1.
What is the InChIKey of 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine?
The InChIKey is IMZOFYAUDSMTTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-9-7(8)5-3-4-6(10-7)11-2/h3-5,9-10H,8H2,1-2H3.
What are the key properties of 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine?
6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine has a molecular weight of 155.20 g/mol, XLogP of -0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-N'-methyl-1H-pyridine-2,2-diamine is sourced from PubChem (CID 69026533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).