C10H12NO+ — CID 69026554
6,7,8,10-tetrahydropyrido[1,2-a]azepin-5-ium-9-one (PubChem CID 69026554) has the molecular formula C10H12NO+ and a molecular weight of 162.21 g/mol. Its IUPAC name is 6,7,8,10-tetrahydropyrido[1,2-a]azepin-5-ium-9-one.
| Compound Name | 6,7,8,10-tetrahydropyrido[1,2-a]azepin-5-ium-9-one |
|---|---|
| PubChem CID | 69026554 |
| Molecular Formula | C10H12NO+ |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 6,7,8,10-tetrahydropyrido[1,2-a]azepin-5-ium-9-one |
| SMILES | O=C1CCC[n+]2ccccc2C1 |
| InChI | InChI=1S/C10H12NO/c12-10-5-3-7-11-6-2-1-4-9(11)8-10/h1-2,4,6H,3,5,7-8H2/q+1 |
| InChIKey | DOAXYVVTWOZZMA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|