About 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide
1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide (PubChem CID 69026589) has the molecular formula C6H14BrN3O
and a molecular weight of 224.10 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide |
| PubChem CID | 69026589 |
| Molecular Formula | C6H14BrN3O |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide |
| SMILES | Br.COCCN1CCN=C1N |
| InChI | InChI=1S/C6H13N3O.BrH/c1-10-5-4-9-3-2-8-6(9)7;/h2-5H2,1H3,(H2,7,8);1H |
| InChIKey | KOXJIEFQJSWJNC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide?
The IUPAC name of 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide (CID 69026589) is 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide.
What is the SMILES notation for 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide?
The canonical SMILES for 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide is Br.COCCN1CCN=C1N.
What is the InChIKey of 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide?
The InChIKey is KOXJIEFQJSWJNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O.BrH/c1-10-5-4-9-3-2-8-6(9)7;/h2-5H2,1H3,(H2,7,8);1H.
What are the key properties of 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide?
1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide has a molecular weight of 224.10 g/mol, XLogP of -0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine;hydrobromide is sourced from PubChem (CID 69026589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).