About CID 69026605
CID 69026605 (PubChem CID 69026605) has the molecular formula C14H16N2OSi
and a molecular weight of 256.38 g/mol.
Molecular Properties
| Compound Name | CID 69026605 |
| PubChem CID | 69026605 |
| Molecular Formula | C14H16N2OSi |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)O[Si]c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C14H16N2OSi/c1-14(2,3)17-18-11-7-8-13(16-10-11)12-6-4-5-9-15-12/h4-10H,1-3H3 |
| InChIKey | ZBSASTVNNURIKK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 69026605 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69026605?
The IUPAC name of CID 69026605 (CID 69026605) is not available.
What is the SMILES notation for CID 69026605?
The canonical SMILES for CID 69026605 is CC(C)(C)O[Si]c1ccc(-c2ccccn2)nc1.
What is the InChIKey of CID 69026605?
The InChIKey is ZBSASTVNNURIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2OSi/c1-14(2,3)17-18-11-7-8-13(16-10-11)12-6-4-5-9-15-12/h4-10H,1-3H3.
What are the key properties of CID 69026605?
CID 69026605 has a molecular weight of 256.38 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69026605 is sourced from PubChem (CID 69026605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).