C20H32O6 — CID 69026792
(2S,3R,4S,5S,6R)-2-ethoxy-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane (PubChem CID 69026792) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-ethoxy-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5S,6R)-2-ethoxy-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 69026792 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-ethoxy-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOC[C@H]1O[C@H](OCC)[C@H](OCC=C)[C@@H](OCC=C)[C@H]1OCC=C |
| InChI | InChI=1S/C20H32O6/c1-6-11-21-15-16-17(23-12-7-2)18(24-13-8-3)19(25-14-9-4)20(26-16)22-10-5/h6-9,16-20H,1-4,10-15H2,5H3/t16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | SZUNTMUPLUVQBE-CXQPBAHBSA-N |
| XLogP | 2.66 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|