About 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide
1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide (PubChem CID 69026805) has the molecular formula C6H14BrN3
and a molecular weight of 208.10 g/mol. Its IUPAC name is 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide |
| PubChem CID | 69026805 |
| Molecular Formula | C6H14BrN3 |
| Molecular Weight | 208.10 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide |
| SMILES | Br.CC(C)N1CCN=C1N |
| InChI | InChI=1S/C6H13N3.BrH/c1-5(2)9-4-3-8-6(9)7;/h5H,3-4H2,1-2H3,(H2,7,8);1H |
| InChIKey | FKPKFHFORZKTJO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.10 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide?
The IUPAC name of 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide (CID 69026805) is 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide.
What is the SMILES notation for 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide?
The canonical SMILES for 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide is Br.CC(C)N1CCN=C1N.
What is the InChIKey of 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide?
The InChIKey is FKPKFHFORZKTJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3.BrH/c1-5(2)9-4-3-8-6(9)7;/h5H,3-4H2,1-2H3,(H2,7,8);1H.
What are the key properties of 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide?
1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide has a molecular weight of 208.10 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-4,5-dihydroimidazol-2-amine;hydrobromide is sourced from PubChem (CID 69026805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).