C26H22N2O7S2 — CID 69027063
2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline;sulfo hydrogen sulfate (PubChem CID 69027063) has the molecular formula C26H22N2O7S2 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline;sulfo hydrogen sulfate.
| Compound Name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline;sulfo hydrogen sulfate |
|---|---|
| PubChem CID | 69027063 |
| Molecular Formula | C26H22N2O7S2 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline;sulfo hydrogen sulfate |
| SMILES | Cc1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(C)nc3c2n1.O=S(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/C26H20N2.H2O7S2/c1-17-15-23(19-9-5-3-6-10-19)21-13-14-22-24(20-11-7-4-8-12-20)16-18(2)28-26(22)25(21)27-17;1-8(2,3)7-9(4,5)6/h3-16H,1-2H3;(H,1,2,3)(H,4,5,6) |
| InChIKey | XSPYCHRVBLEOKO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 143.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|