C36H35F3N4O6 — CID 69027526
3-(4-phenylphenyl)-3-[N-[(2R)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]-4-(2,2,2-trifluoroacetyl)oxyanilino]propanoic acid (PubChem CID 69027526) has the molecular formula C36H35F3N4O6 and a molecular weight of 676.69 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[N-[(2R)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]-4-(2,2,2-trifluoroacetyl)oxyanilino]propanoic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[N-[(2R)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]-4-(2,2,2-trifluoroacetyl)oxyanilino]propanoic acid |
|---|---|
| PubChem CID | 69027526 |
| Molecular Formula | C36H35F3N4O6 |
| Molecular Weight | 676.69 g/mol |
| Exact Mass | 676.25 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[N-[(2R)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]-4-(2,2,2-trifluoroacetyl)oxyanilino]propanoic acid |
| SMILES | C[C@@H](NC(=O)CCCCNc1ccccn1)C(=O)N(c1ccc(OC(=O)C(F)(F)F)cc1)C(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H35F3N4O6/c1-24(42-32(44)12-6-8-22-41-31-11-5-7-21-40-31)34(47)43(28-17-19-29(20-18-28)49-35(48)36(37,38)39)30(23-33(45)46)27-15-13-26(14-16-27)25-9-3-2-4-10-25/h2-5,7,9-11,13-21,24,30H,6,8,12,22-23H2,1H3,(H,40,41)(H,42,44)(H,45,46)/t24-,30?/m1/s1 |
| InChIKey | UTGFGBPDOCVVST-DDAUYOFQSA-N |
| XLogP | 6.55 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.69 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|