C26H33N7O3 — CID 69028196
8-[1-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 69028196) has the molecular formula C26H33N7O3 and a molecular weight of 491.60 g/mol. Its IUPAC name is 8-[1-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[1-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 69028196 |
| Molecular Formula | C26H33N7O3 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 8-[1-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cnn(CC4CCN(c5ccc(OC)cc5)C4)c3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C26H33N7O3/c1-4-11-32-24-22(25(34)33(12-5-2)26(32)35)28-23(29-24)19-14-27-31(17-19)16-18-10-13-30(15-18)20-6-8-21(36-3)9-7-20/h6-9,14,17-18H,4-5,10-13,15-16H2,1-3H3,(H,28,29) |
| InChIKey | NPUPIAZFZHGANI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|