About 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine
4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine (PubChem CID 69028562) has the molecular formula C22H21F3N2O2S
and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine |
| PubChem CID | 69028562 |
| Molecular Formula | C22H21F3N2O2S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine |
| SMILES | Cc1cnc(-c2cc(-c3ccccc3)c(N3CCOCC3)s2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O2S/c1-15-13-26-18(12-19(15)29-14-22(23,24)25)20-11-17(16-5-3-2-4-6-16)21(30-20)27-7-9-28-10-8-27/h2-6,11-13H,7-10,14H2,1H3 |
| InChIKey | YDRWOACUJOWOAO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine?
The IUPAC name of 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine (CID 69028562) is 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine.
What is the SMILES notation for 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine?
The canonical SMILES for 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine is Cc1cnc(-c2cc(-c3ccccc3)c(N3CCOCC3)s2)cc1OCC(F)(F)F.
What is the InChIKey of 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine?
The InChIKey is YDRWOACUJOWOAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F3N2O2S/c1-15-13-26-18(12-19(15)29-14-22(23,24)25)20-11-17(16-5-3-2-4-6-16)21(30-20)27-7-9-28-10-8-27/h2-6,11-13H,7-10,14H2,1H3.
What are the key properties of 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine?
4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine has a molecular weight of 434.48 g/mol, XLogP of 5.56, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[5-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-phenylthiophen-2-yl]morpholine is sourced from PubChem (CID 69028562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).